5400-77-1 Usage
Uses
Used in Pharmaceutical Industry:
2,6-diiodo-3-methyl-4-nitro-aniline is used as an intermediate in the synthesis of pharmaceuticals, playing a crucial role in the production of various medicinal compounds. Its unique chemical structure allows it to be a versatile building block for the development of new drugs.
Used in Pigment and Dye Industry:
2,6-diiodo-3-methyl-4-nitro-aniline is utilized as an intermediate in the production of pigments and dyes, contributing to the creation of a wide range of colorants used in various applications, including textiles, plastics, and printing inks.
Used in Organic Synthesis:
2,6-diiodo-3-methyl-4-nitro-aniline serves as a reagent in organic synthesis, facilitating various chemical reactions and transformations. Its presence can enhance the efficiency and selectivity of certain synthetic processes.
Used in Preparation of Iodinated Compounds:
As a starting material, 2,6-diiodo-3-methyl-4-nitro-aniline is employed in the preparation of novel iodinated compounds. These iodinated products have potential applications in various fields, such as medicine, imaging, and analytical chemistry.
Safety Considerations:
Due to its potentially harmful nature, 2,6-diiodo-3-methyl-4-nitro-aniline should be handled with care in a laboratory setting. It poses risks if ingested, inhaled, or comes into contact with skin and eyes, necessitating proper safety measures during its use and storage.
Check Digit Verification of cas no
The CAS Registry Mumber 5400-77-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,0 and 0 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5400-77:
(6*5)+(5*4)+(4*0)+(3*0)+(2*7)+(1*7)=71
71 % 10 = 1
So 5400-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H6I2N2O2/c1-3-5(11(12)13)2-4(8)7(10)6(3)9/h2H,10H2,1H3
