54367-66-7 Usage
Uses
Used in Scientific Research and Development:
5-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid is used as a research chemical for the exploration of its chemical properties and potential applications in various fields. Its unique structure allows it to be a valuable component in the synthesis of new compounds and materials.
Used in Chemical Synthesis:
In the field of organic chemistry, 5-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid is employed as a building block or intermediate in the synthesis of more complex molecules. Its reactivity and functional groups make it a useful precursor for the creation of pharmaceuticals, agrochemicals, or other specialty chemicals.
Used in Material Science:
5-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid may also find applications in material science, where its properties could be harnessed to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity in certain processes.
Used in Pharmaceutical Development:
Given its structural features, 5-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid could be utilized in the pharmaceutical industry as a starting material for the development of new drugs. Its potential to form various chemical bonds and its mild acidity may contribute to the design of novel therapeutic agents.
Used in Agrochemical Formulation:
In the agrochemical industry, 5-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid could be used as a component in the formulation of new pesticides or herbicides. Its chemical properties may enable the development of more effective and environmentally friendly products for agricultural use.
Check Digit Verification of cas no
The CAS Registry Mumber 54367-66-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,3,6 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54367-66:
(7*5)+(6*4)+(5*3)+(4*6)+(3*7)+(2*6)+(1*6)=137
137 % 10 = 7
So 54367-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5ClN2O2/c1-8-4(6)3(2-7-8)5(9)10/h2H,1H3,(H,9,10)
54367-66-7Relevant academic research and scientific papers
Process for preparing pyrazolecarboxylic acid compounds
-
, (2008/06/13)
There is disclosed a process for preparing a pyrazolecarboxylic acid derivative represented by the formula (II): STR1 wherein Y and Z each represent a hydrogen atom, a halogen atom, a nitro group, a cyano group, COOR1, NR1 R2, CONR1 R2, SR1, SO2 NR1 R2, SO2 R3, R3 CO, OR4, CHX2 or CX3 ; A represents a hydrogen atom, an alkyl group having 1 to 4 carbon atoms, a substituted or unsubstituted phenyl group, a substituted or unsubstituted pyridyl group or OR5 ; where R1 and R2 each represent a hydrogen atom or an alkyl group having 1 to 10 carbon atoms; R3 represents an alkyl group having 1 to 10 carbon atoms; R4 represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, a substituted or unsubstituted phenyl group, CHF2, CF3 or CF3 CH2 ; R5 represents an alkyl group having 1 to 10 carbon atoms; and X represents a halogen atom, which comprises oxidizing a pyrazole compound represented by the formula (I): STR2 wherein Y, Z and A have the same meanings as defined above, with an oxygen-containing gas in the presence of a metal compound catalyst.
Synthesis of Pyrazole Carboxylic Acid via Cobalt-Catalyzed Liquid Phase Oxidation
Tanaka, Norio,Shinke, Shuzo,Takigawa, Shinichiro
, p. 585 - 588 (2007/10/02)
In the presence of catalytic amount of cobalt acetate(II), manganese acetate(II) and bromide ion, the selective oxidation of 3,5-dichloro-1,4-dimethylpyrazole with molecular oxygen afforded 3,5-dichloro-1-methylpyrazole-4-carboxylic acid in more than 95percent yield.
Herbicidal and algicidal 1,5-disubstituted-1H-pyrazole-4-carboxamides
-
, (2008/06/13)
1,5-Disubstituted-1H-pyrazole-4-carboxamide derivatives, useful as herbicides and aquatic algicides.
