5448-32-8 Usage
Uses
Used in Pharmaceutical Industry:
(4-Methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methanol is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and functional groups.
Used in Materials Science:
(4-Methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methanol is used as a component in the development of new materials due to its potential to form stable structures and contribute to the properties of the materials.
Note: The specific uses and properties of (4-Methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methanol would need to be further investigated through research and testing to fully understand its potential applications and benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 5448-32-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5448-32:
(6*5)+(5*4)+(4*4)+(3*8)+(2*3)+(1*2)=98
98 % 10 = 8
So 5448-32-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-11(7-13)8-14-10(12-11)9-5-3-2-4-6-9/h2-6,13H,7-8H2,1H3
