5462-65-7 Usage
Chemical class
Pyrrolidine derivatives
Structural features
Presence of two chlorophenyl groups
Presence of one methoxyphenyl group
Presence of an imino functional group
Potential applications
Medicinal chemistry and drug development
Biological activity
May exhibit biological activity due to its structural features
Therapeutic potential
May lead to the discovery of new pharmaceutical agents
Research status
Further research is needed to fully understand its pharmacological properties and potential uses
Please note that the compound's specific properties, such as solubility, stability, and reactivity, are not provided in the material. Additional research and experimentation would be required to determine these properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5462-65-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5462-65:
(6*5)+(5*4)+(4*6)+(3*2)+(2*6)+(1*5)=97
97 % 10 = 7
So 5462-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C23H18Cl2N2O2/c1-29-20-10-8-15(9-11-20)22-14-21(26-18-6-2-4-16(24)12-18)23(28)27(22)19-7-3-5-17(25)13-19/h2-13,22H,14H2,1H3/b26-21+