5469-30-7 Usage
Uses
Used in Pharmaceutical Synthesis:
(1S,2S)-2-chlorocyclohexane-1-carboxylic acid is utilized as an intermediate in the synthesis of pharmaceuticals due to its versatile carboxylic acid group, which can be used to form various organic compounds. Its chiral nature is particularly valuable in the production of enantiomerically pure drugs, which can have different biological activities and reduce potential side effects.
Used in Agrochemical Production:
In the agrochemical industry, (1S,2S)-2-chlorocyclohexane-1-carboxylic acid serves as a key intermediate for the synthesis of various agrochemicals. The presence of the chlorine atom and the carboxylic acid group allows for the creation of compounds with specific pesticidal or herbicidal properties, contributing to the development of effective crop protection agents.
Check Digit Verification of cas no
The CAS Registry Mumber 5469-30-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 9 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5469-30:
(6*5)+(5*4)+(4*6)+(3*9)+(2*3)+(1*0)=107
107 % 10 = 7
So 5469-30-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H11ClO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4H2,(H,9,10)/t5-,6+/m1/s1
