55154-90-0 Usage
Uses
Used in Pharmaceutical Research and Development:
2-(4-Chloro-phenyl)-acetamidine is used as a key intermediate in the synthesis of various pharmaceuticals for its potential therapeutic applications. Its unique structure allows it to interact with biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, 2-(4-Chloro-phenyl)-acetamidine serves as a valuable compound for studying the properties and reactions of acetamidine derivatives. Its reactivity and stability contribute to a deeper understanding of organic chemistry and the development of novel synthetic pathways.
Used in Drug Discovery:
2-(4-Chloro-phenyl)-acetamidine is employed as a lead compound in drug discovery, where its pharmacological properties are evaluated for potential use in treating specific diseases and conditions. Its unique structure and functional groups make it an attractive candidate for further optimization and development into effective therapeutic agents.
Used in Medicinal Chemistry:
In medicinal chemistry, 2-(4-Chloro-phenyl)-acetamidine is utilized for the design and synthesis of new bioactive molecules. Its versatile chemical properties enable the creation of diverse chemical entities with potential therapeutic benefits, contributing to the advancement of medicinal chemistry and drug development.
Overall, 2-(4-Chloro-phenyl)-acetamidine is a versatile chemical compound with significant potential in various applications across pharmaceutical research, chemical research, drug discovery, and medicinal chemistry. Its unique structure and pharmacological properties make it a valuable asset in the development of new therapeutic agents and the advancement of scientific knowledge in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 55154-90-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,1,5 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 55154-90:
(7*5)+(6*5)+(5*1)+(4*5)+(3*4)+(2*9)+(1*0)=120
120 % 10 = 0
So 55154-90-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2.ClH/c9-7-3-1-6(2-4-7)5-8(10)11;/h1-4H,5H2,(H3,10,11);1H
55154-90-0Relevant academic research and scientific papers
Evolution of anti-HIV drug candidates. Part 1: From α-Anilinophenylacetamide (α-APA) to imidoyl thiourea (ITU)
Ludovici, Donald W.,Kukla, Michael J.,Grous, Philip G.,Krishnan, Suma,Andries, Koen,De Bethune, Marie-Pierre,Azijn, Hilde,Pauwels, Rudi,De Clercq, Erik,Arnold, Edward,Janssen, Paul A.J.
, p. 2225 - 2228 (2007/10/03)
Stemming from work on a previous clinical candidate, loviride, and other α-APA derivatives, a new series of potent non-nucleoside reverse transcriptase inhibitors (NNRTIs) has been synthesized. The ITU analogues, which contain a unique diarylated imidoyl thiourea, are very active in inhibiting both wild-type and clinically important mutant strains of HIV-1.
Serotonin antagonists
-
, (2008/06/13)
A compound of the formula EQU1 or an acid addition salt thereof wherein R1 and R2 are the same or different and each is a phenyl or thien-2-yl group optionally substituted in one or more positions by a substituent selected from the class consisting of halogen, lower alkyl, lower alkoxy, hydroxy, lower alkylthio, phenyl, phenoxy, phenyl-(lower-alkyl) and phenyl-(lower-alkoxy), each of the said phenyl, phenoxy, phenyl-(lower-alkyl) and phenyl-(lower-alkoxy) substituent groups being optionally substituted in one or more positions by a member selected from the class consisting of halogen, lower alkyl, lower alkoxy, hydroxy, and lower alkylthio; A1 is a divalent straight or branched alkylene group containing from two to six carbon atoms and one or two divalent atoms which are each an oxygen or sulphur atom, provided that there are at least two carbon atoms between the divalent atom and the --NH-- group and between the two divalent atoms; and A2 is the methylene group --CH2 --.
