55277-85-5 Usage
Uses
Used in Pharmaceutical Industry:
Disodium phenylmalonate is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to facilitate the formation of complex organic molecules. Its reactivity in organic reactions contributes to the development of new drugs and medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical sector, disodium phenylmalonate is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its role in organic synthesis aids in the creation of effective and targeted chemical agents for agricultural applications.
Used in Materials Science:
Disodium phenylmalonate is employed as a component in the development of new materials with specific properties in materials science. Its involvement in organic reactions allows for the synthesis of materials with tailored characteristics for various applications.
Used as a Chelating Agent:
Disodium phenylmalonate is used as a chelating agent for its potential in metal ion extraction and environmental remediation processes. Its ability to form complexes with metal ions makes it a candidate for applications in waste treatment and purification systems.
Check Digit Verification of cas no
The CAS Registry Mumber 55277-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,2,7 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55277-85:
(7*5)+(6*5)+(5*2)+(4*7)+(3*7)+(2*8)+(1*5)=145
145 % 10 = 5
So 55277-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8O4.2Na/c10-8(11)7(9(12)13)6-4-2-1-3-5-6;;/h1-5,7H,(H,10,11)(H,12,13);;/q;2*+1/p-2
