55304-85-3 Usage
Description
2,6-Dibromo-3-pyridinecarboxylic acid is a chemical compound belonging to the pyridinecarboxylic acid family, characterized by its molecular formula C7H4Br2NO2. It features a pyridine ring with two bromine atoms attached at the 2 and 6 positions, which endows it with a high level of reactivity. 2,6-Dibromo-3-pyridinecarboxylic acid is widely utilized in organic synthesis and serves as a crucial intermediate in the production of pharmaceuticals and agrochemicals, making it a valuable asset in the fields of medicinal chemistry and drug discovery.
Uses
Used in Organic Synthesis:
2,6-Dibromo-3-pyridinecarboxylic acid is used as a key intermediate in organic synthesis for the production of various pharmaceuticals and agrochemicals. Its high reactivity allows it to participate in cross-coupling reactions and other organic transformations, facilitating the creation of a diverse range of chemical compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,6-Dibromo-3-pyridinecarboxylic acid is used as a building block for the development of new drugs. Its unique structure and reactivity make it a promising candidate for the synthesis of therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Agrochemical Industry:
2,6-Dibromo-3-pyridinecarboxylic acid is also utilized in the agrochemical industry as an intermediate for the synthesis of pesticides and other crop protection agents. Its ability to form stable and effective compounds makes it a valuable component in the development of innovative and environmentally friendly agrochemical products.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,6-Dibromo-3-pyridinecarboxylic acid is employed for drug discovery and development. Its unique chemical properties and potential to form a wide range of compounds make it an attractive starting material for the design and synthesis of novel therapeutic agents with improved efficacy and selectivity.
Overall, 2,6-Dibromo-3-pyridinecarboxylic acid is a versatile and valuable chemical compound with diverse applications across various industries, particularly in the development of pharmaceuticals, agrochemicals, and other organic compounds. Its high reactivity and potential for cross-coupling reactions make it an essential component in the synthesis of innovative and effective products.
Check Digit Verification of cas no
The CAS Registry Mumber 55304-85-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,3,0 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55304-85:
(7*5)+(6*5)+(5*3)+(4*0)+(3*4)+(2*8)+(1*5)=113
113 % 10 = 3
So 55304-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11)
55304-85-3Relevant articles and documents
BICYCLIC INHIBITORS OF ALK
-
Page/Page column 69-70, (2012/08/07)
The present invention relates to compounds of formula (1) or pharmaceutical acceptable salts, wherein R1, X, Y, Z, A, B, G1, and n are defined in the description. The present invention relates also to compositions containing said compounds which are useful for inhibiting kinases such as ALK and methods of treating diseases such as cancer.
NITROGENATED FUSED RING DERIVATIVE, PHARMACEUTICAL COMPOSITION COMPRISING THE SAME, AND USE OF THE SAME FOR MEDICAL PURPOSES
-
Page/Page column 25, (2010/01/29)
[Purpose] The present invention provides compounds useful as agents for the prevention or treatment of a sex hormone-dependent disease or the like. [Solution] The present invention provides nitrogen-containing fused ring derivatives represented by the following general formula (I) which has a GnRH antagonistic activity, prodrugs, salts, pharmaceutical compositions containing the same, medicinal uses thereof and the like. In the formula (I), rings A and B are independently aryl or heteroaryl; RA and RB are independently halogen, cyano, alkyl, alkylsulfonyl, -OW1, -SW1, -COW2, -NW3W4, -SO2NW3W4, aryl, etc.; RC is H or alkyl; E is oxygen atom, etc.; U is single bond or alkylene; and X is Y, -CO-Y, -SO2-Y -S-(alkylene)-Y, -O-(alkylene)-Y, -SO2-(alkylene)-Y, etc.; Y is Z or amino, etc.; and Z is cycloalkyl, heterocycloalkyl, aryl, heteroaryl, etc.
