55933-85-2 Usage
Uses
Used in Organic Synthesis:
5-Acetyl-2,4-dimethylpyrimidine is used as a building block in organic synthesis for its ability to contribute to the formation of complex organic compounds. Its unique structure allows it to be a key component in creating a wide range of chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-Acetyl-2,4-dimethylpyrimidine is utilized as a starting material for the development of new drugs and pharmaceutical products. Its reactivity and structural features make it a promising candidate for medicinal chemistry, potentially leading to the discovery of novel therapeutic agents.
Used as a Reagent in Chemical Reactions:
5-Acetyl-2,4-dimethylpyrimidine also serves as a reagent in various chemical reactions, facilitating the synthesis of other compounds. Its role in these reactions is crucial for achieving desired outcomes in chemical processes.
Used in Materials Science:
5-ACETYL-2,4-DIMETHYLPYRIMIDINE's properties extend its utility to the field of materials science, where it may be employed in the development of new materials with specific properties, such as those with unique electronic, optical, or mechanical characteristics.
Overall, 5-acetyl-2,4-dimethylpyrimidine's diverse applications across chemistry, pharmaceuticals, and materials science underscore its importance as a versatile chemical entity.
Check Digit Verification of cas no
The CAS Registry Mumber 55933-85-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,3 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55933-85:
(7*5)+(6*5)+(5*9)+(4*3)+(3*3)+(2*8)+(1*5)=152
152 % 10 = 2
So 55933-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c1-5-8(6(2)11)4-9-7(3)10-5/h4H,1-3H3
