565-76-4 Usage
Uses
Used in Chemical Production:
2,3,4-Trimethyl-1-pentene is used as a chemical intermediate for the synthesis of other chemicals, such as fragrances and additives, due to its reactive nature and ability to undergo various chemical transformations.
Used in the Manufacturing of Resins, Plastics, and Synthetic Rubber:
2,3,4-Trimethyl-1-pentene. is utilized in the production of resins, plastics, and synthetic rubber, where its properties contribute to the formation of materials with specific characteristics required for various applications.
Used in Industrial Processes as a Solvent:
2,3,4-Trimethyl-1-pentene is employed as a solvent in different industrial processes, leveraging its ability to dissolve a wide range of substances and facilitate chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 565-76-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,6 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 565-76:
(5*5)+(4*6)+(3*5)+(2*7)+(1*6)=84
84 % 10 = 4
So 565-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-6(2)8(5)7(3)4/h7-8H,1H2,2-5H3
