57059-24-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Thiophenecarboxamide,3-hydroxy-(9CI) is used as an intermediate in the production of pharmaceuticals for its potential therapeutic properties. It contributes to the development of new drugs by providing a structural foundation that can be modified to target specific medical conditions.
Used in Agriculture:
In the agricultural sector, 2-Thiophenecarboxamide,3-hydroxy-(9CI) is utilized as an intermediate in the synthesis of agrochemicals. Its role is crucial in creating compounds that can be used for pest control, crop protection, and other agricultural applications, thereby enhancing crop yields and quality.
Used in Organic Synthesis:
2-Thiophenecarboxamide,3-hydroxy-(9CI) serves as a building block in organic synthesis, where it is used to create a wide range of other chemical compounds. Its unique structure allows for the formation of various derivatives, expanding the scope of chemical research and innovation in multiple fields.
Check Digit Verification of cas no
The CAS Registry Mumber 57059-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,0,5 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 57059-24:
(7*5)+(6*7)+(5*0)+(4*5)+(3*9)+(2*2)+(1*4)=132
132 % 10 = 2
So 57059-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NO2S/c6-5(8)4-3(7)1-2-9-4/h1-2,7H,(H2,6,8)
