57712-57-9 Usage
Pyrimidine family
A member This compound belongs to the pyrimidine family, which is a group of organic compounds that are used as building blocks in the synthesis of various pharmaceuticals and biologically active molecules.
Carbonitrile group
Contains The presence of a carbonitrile group (C≡N) in the compound, which is a functional group consisting of a carbon atom triple-bonded to a nitrogen atom, influences its chemical properties and reactivity.
Potential applications
Medicinal chemistry and drug development Due to its structural features, this compound may be useful as a building block in the synthesis of biologically active molecules, making it relevant in the field of medicinal chemistry and drug development.
Hazardous properties
Handle with care 1-Ethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile may possess hazardous properties, so it is essential to handle it with caution and follow proper safety protocols.
Professional use
Only for trained professionals and appropriate laboratory settings This chemical should only be used by trained professionals in suitable laboratory environments to ensure safe handling and minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 57712-57-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,7,1 and 2 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 57712-57:
(7*5)+(6*7)+(5*7)+(4*1)+(3*2)+(2*5)+(1*7)=139
139 % 10 = 9
So 57712-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O2/c1-2-10-4-5(3-8)6(11)9-7(10)12/h4H,2H2,1H3,(H,9,11,12)