58161-36-7 Usage
Uses
Used in Organic Synthesis:
N-(3-oxo-2,3-dihydro-1H-inden-4-yl)acetamide is utilized as a building block in the synthesis of various biologically active molecules. Its unique structure allows it to be a key component in creating compounds that possess significant biological activity, thereby contributing to the development of new pharmaceutical agents.
Used in Pharmaceutical Research:
In the pharmaceutical industry, N-(3-oxo-2,3-dihydro-1H-inden-4-yl)acetamide serves as a potential lead compound in drug discovery. Its specific structural features make it a promising candidate for further exploration and optimization to develop new drugs with therapeutic potential.
Used as a Precursor in Industrial and Academic Research:
N-(3-oxo-2,3-dihydro-1H-inden-4-yl)acetamide also finds application as a precursor in the production of various organic compounds. Its role in this context is crucial for both industrial applications and academic research, where it can be used to explore new chemical reactions and synthesize novel compounds for a range of purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 58161-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,6 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 58161-36:
(7*5)+(6*8)+(5*1)+(4*6)+(3*1)+(2*3)+(1*6)=127
127 % 10 = 7
So 58161-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2/c1-7(13)12-9-4-2-3-8-5-6-10(14)11(8)9/h2-4H,5-6H2,1H3,(H,12,13)
