58268-08-9 Usage
Uses
Used in Organic Synthesis:
2-(1,3-DIOXOLAN-2-YL)THIOPHENE is used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and functional materials, leveraging its distinctive chemical properties to create a wide range of compounds with specific therapeutic or functional attributes.
Used in Material Science:
In the field of material science, 2-(1,3-DIOXOLAN-2-YL)THIOPHENE is utilized for its potential in developing organic electronic devices. Its application is particularly notable in the creation of organic light-emitting diodes (OLEDs) and organic photovoltaic cells, where its structural features contribute to the performance and efficiency of these devices.
Used in Coordination Chemistry:
2-(1,3-Dioxolan-2-yl)thiophene also serves as a ligand in coordination chemistry, playing a crucial role in the formation and properties of metal complexes. Its ability to chelate with metal ions can influence the stability, reactivity, and selectivity of the resulting complexes.
Used in Heterocyclic Compound Synthesis:
Furthermore, 2-(1,3-DIOXOLAN-2-YL)THIOPHENE is employed as a precursor in the synthesis of other heterocyclic compounds. Its presence in the starting materials can direct the formation of complex heterocyclic structures with potential applications in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 58268-08-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,6 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58268-08:
(7*5)+(6*8)+(5*2)+(4*6)+(3*8)+(2*0)+(1*8)=149
149 % 10 = 9
So 58268-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5,7H,3-4H2
