58800-57-0 Usage
Description
1,2-Di-O-acetyl-5-benzoyl-3-O-Methyl-alpha-D-ribofuranose is a complex organic compound that consists of a ribose sugar molecule modified with acetyl and benzoyl groups. It is commonly used in chemical research and pharmaceutical synthesis as a starting material for the production of various pharmaceuticals and bioactive compounds. Due to its intricate structure, it has the potential to interact with biological systems and is often studied for its potential biological activities. Its specific chemical properties and potential applications make it an important compound in the field of medicinal chemistry and drug discovery.
Uses
Used in Pharmaceutical Industry:
1,2-Di-O-acetyl-5-benzoyl-3-O-Methyl-alpha-D-ribofuranose is used as a starting material for the synthesis of various pharmaceuticals and bioactive compounds. Its unique structure allows it to be modified and incorporated into a wide range of drug molecules, making it a valuable asset in the development of new medications.
Used in Chemical Research:
1,2-Di-O-acetyl-5-benzoyl-3-O-Methyl-alpha-D-ribofuranose is used as a research compound to study its potential biological activities and interactions with biological systems. Its complex structure and chemical properties make it an interesting subject for scientific investigation, which can lead to a better understanding of its potential applications in medicine and other fields.
Used in Drug Discovery:
1,2-Di-O-acetyl-5-benzoyl-3-O-Methyl-alpha-D-ribofuranose is used in drug discovery efforts to identify new therapeutic agents and develop innovative treatments for various diseases and conditions. Its unique structure and potential to interact with biological systems make it a promising candidate for the development of novel drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 58800-57-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,0 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58800-57:
(7*5)+(6*8)+(5*8)+(4*0)+(3*0)+(2*5)+(1*7)=140
140 % 10 = 0
So 58800-57-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H20O8/c1-10(18)23-15-14(21-3)13(25-17(15)24-11(2)19)9-22-16(20)12-7-5-4-6-8-12/h4-8,13-15,17H,9H2,1-3H3
58800-57-0Relevant articles and documents
MODIFIED CYCLIC DINUCLEOSIDE COMPOUNDS AS STING MODULATORS
-
Paragraph 0442, (2020/11/23)
Provided herein are compounds of Formula (I), Formula (II) and/or Formula (III), or pharmaceutically acceptable salts of any of the foregoing, pharmaceutical compositions that include a compound described herein (including pharmaceutically acceptable salt
A total synthesis of mycalisine A
Dou, Yan-Hui,Ding, Hai-Xin,Yang, Ru-Chun,Li, Wei,Xiao, Qiang
, p. 379 - 382 (2013/07/04)
In this paper, we report a total synthesis of a naturally occurring pyrrolo[2,3-d]pyrimidine nucleoside, mycalisine A. Our synthetic strategy uses d-xylose as the starting material and Vorbrüggen glycosylation as the key step. Mycalisine A was synthesized in 11 steps with a 15% overall yield.