5923-43-3 Usage
General Description
3-Phenylcarbazic acid 2-chloroethyl ester, also known as ethyl 3-phenylcarbazate, is a chemical compound commonly used in organic synthesis. It is a white to off-white solid that is soluble in organic solvents such as ethanol and acetone. 3-Phenylcarbazic acid 2-chloroethyl ester is utilized in the production of pharmaceuticals, dyes, and agrochemicals. It is also used as a reactant in the synthesis of various organic compounds and as an intermediate in the production of other chemical substances. Additionally, 3-Phenylcarbazic acid 2-chloroethyl ester may have applications in the development of new materials and catalysts due to its versatile chemical reactivity and potential for functionalization. Overall, this compound has a range of uses in various industries and research fields due to its properties and potential for chemical modification.
Check Digit Verification of cas no
The CAS Registry Mumber 5923-43-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,2 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5923-43:
(6*5)+(5*9)+(4*2)+(3*3)+(2*4)+(1*3)=103
103 % 10 = 3
So 5923-43-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11ClN2O2/c10-6-7-14-9(13)12-11-8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,12,13)
