59577-32-1 Usage
Uses
Used in Pharmaceutical Synthesis:
MOZ-ON is used as a key intermediate in the synthesis of biotinylated ampicillin sulfone, a bifunctional mechanism-based inhibitor. This inhibitor is specifically designed for the selection of active site serine β-lactamases, which are enzymes that can hydrolyze the β-lactam ring of antibiotics, rendering them ineffective. By incorporating MOZ-ON into the synthesis process, it contributes to the development of more effective antibiotics that can combat resistant bacterial strains.
Used in Chemical Research:
As an organic building block, MOZ-ON is utilized in the development of new chemical compounds and materials. Its unique structure allows for various chemical reactions and modifications, making it a valuable component in the creation of novel molecules with potential applications in different industries, such as pharmaceuticals, agrochemicals, and materials science.
Used in the Synthesis of Bioactive Molecules:
MOZ-ON's structural properties make it a suitable candidate for the synthesis of bioactive molecules with potential therapeutic applications. Its ability to form diverse chemical entities can lead to the discovery of new drugs or drug candidates that can target specific biological pathways or receptors, contributing to the advancement of medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 59577-32-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,7 and 7 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59577-32:
(7*5)+(6*9)+(5*5)+(4*7)+(3*7)+(2*3)+(1*2)=171
171 % 10 = 1
So 59577-32-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2O4/c1-21-15-9-7-13(8-10-15)12-22-17(20)23-19-16(11-18)14-5-3-2-4-6-14/h2-10H,12H2,1H3