604-46-6 Usage
General Description
2,3,5,7-Tetrahydroxy-1,4-naphthoquinone, also known as vitamin K2, is a chemical compound that is essential for normal blood clotting and bone metabolism. It is a fat-soluble vitamin that plays a crucial role in the synthesis of proteins involved in blood coagulation and bone mineralization. 2,3,5,7-Tetrahydroxy-1,4-naphthoquinone is found in green leafy vegetables, dairy products, and certain animal products. It is also produced by bacteria in the human gut. Vitamin K2 has been studied for its potential health benefits, such as reducing the risk of osteoporosis and cardiovascular disease, and may have anti-inflammatory and anti-cancer properties.
Check Digit Verification of cas no
The CAS Registry Mumber 604-46-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,0 and 4 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 604-46:
(5*6)+(4*0)+(3*4)+(2*4)+(1*6)=56
56 % 10 = 6
So 604-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H6O6/c11-3-1-4-6(5(12)2-3)8(14)10(16)9(15)7(4)13/h1-2,11-14H
