60717-49-9 Usage
Uses
Used in Organic Synthesis:
DIMETHYL-(2-PIPERIDIN-2-YL-ETHYL)-AMINE is utilized as a building block in organic synthesis for its ability to contribute to the formation of complex molecular structures. Its unique structural features make it a valuable component in the synthesis of a wide array of organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, DIMETHYL-(2-PIPERIDIN-2-YL-ETHYL)-AMINE is employed as a reagent in the preparation of other compounds, particularly those with potential therapeutic applications. Its role in drug development is underscored by its capacity to enhance the properties of pharmaceutical agents.
Used as a Catalyst in Chemical Reactions:
DIMETHYL-(2-PIPERIDIN-2-YL-ETHYL)-AMINE also serves as a catalyst, facilitating certain chemical reactions by lowering the activation energy required for the reaction to proceed. This function is crucial in various industrial processes, where it can improve the efficiency and selectivity of chemical transformations.
Investigated for Pharmacological Properties:
DIMETHYL-(2-PIPERIDIN-2-YL-ETHYL)-AMINE has been the subject of research for its potential pharmacological properties, indicating its use in the discovery and development of new drugs. Its exploration in this context is driven by the hope of identifying novel therapeutic agents that can address unmet medical needs.
Overall, DIMETHYL-(2-PIPERIDIN-2-YL-ETHYL)-AMINE is a multifunctional chemical entity with applications that span across different sectors of the chemical and pharmaceutical industries, underpinning its significance in the advancement of scientific and medical knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 60717-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,1 and 7 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 60717-49:
(7*6)+(6*0)+(5*7)+(4*1)+(3*7)+(2*4)+(1*9)=119
119 % 10 = 9
So 60717-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H20N2/c1-11(2)8-6-9-5-3-4-7-10-9/h9-10H,3-8H2,1-2H3
