6124-13-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 3-Methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate is used as a pharmaceutical intermediate for the development of new drugs. Its unique structure and functional groups make it a promising candidate for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, Ethyl 3-Methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate is used as a key building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its biological and pharmacological properties can be harnessed to create effective and environmentally friendly solutions for crop protection.
Used in Organic Synthesis:
Ethyl 3-Methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate serves as a valuable building block in organic synthesis, enabling the creation of a wide range of chemical compounds with diverse applications. Its versatile structure allows for the development of new molecules with potential uses in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Research and Development:
Due to its unique structure and potential applications, Ethyl 3-Methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate is utilized in research and development efforts to explore its properties and discover new uses. Scientists and researchers in various fields can leverage Ethyl 3-Methyl-5-oxo-[1,3]thiazolo[3,2-a]pyriMidine-6-carboxylate to advance their understanding of chemical reactions and develop innovative solutions to pressing challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 6124-13-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,2 and 4 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6124-13:
(6*6)+(5*1)+(4*2)+(3*4)+(2*1)+(1*3)=66
66 % 10 = 6
So 6124-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3S/c1-3-15-9(14)7-4-11-10-12(8(7)13)6(2)5-16-10/h4-5H,3H2,1-2H3
