62455-63-4 Usage
General Description
2-(4-Methoxybenzoyl)-3,3-di(methylthio)acrylonitrile is a chemical compound with the molecular formula C17H15NO3S and a molar mass of 317.37 g/mol. It is a yellow solid with a molecular structure containing a benzoyl group, a methoxy group, and a acrylonitrile group. 2-(4-METHOXYBENZOYL)-3,3-DI(METHYLTHIO)ACRYLONITRILE is commonly used in organic synthesis and chemical research due to its versatile reactivity. It is utilized in the production of various pharmaceuticals, agrochemicals, and dyes. Additionally, it also shows potential as a precursor for the synthesis of novel materials and compound libraries for drug discovery. Despite its reactivity and potential applications, the chemical should be handled with care due to its potential hazards if not handled properly.
Check Digit Verification of cas no
The CAS Registry Mumber 62455-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,4,5 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 62455-63:
(7*6)+(6*2)+(5*4)+(4*5)+(3*5)+(2*6)+(1*3)=124
124 % 10 = 4
So 62455-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2S2/c1-16-10-6-4-9(5-7-10)12(15)11(8-14)13(17-2)18-3/h4-7H,1-3H3
