6272-88-4 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DiaMino-7-hydroxy-6-pteridineacetic Acid Ethyl Ester is used as a synthetic intermediate for the production of 6-substituted isoxanthopterins and 7-Hydroxy Aminopterin (H797250). These compounds have potential applications in the development of therapeutic drugs, particularly for the treatment of various diseases and conditions.
Used in Chemical Research:
As a key intermediate in the synthesis of pteridine derivatives, 2,4-DiaMino-7-hydroxy-6-pteridineacetic Acid Ethyl Ester is also used in chemical research to explore new compounds and their potential applications in various fields, including medicine, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 6272-88-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,7 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6272-88:
(6*6)+(5*2)+(4*7)+(3*2)+(2*8)+(1*8)=104
104 % 10 = 4
So 6272-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N6O3/c1-2-19-5(17)3-4-9(18)15-8-6(13-4)7(11)14-10(12)16-8/h2-3H2,1H3,(H5,11,12,14,15,16,18)
6272-88-4Relevant academic research and scientific papers
DIVALENT NUCLEOBASE COMPOUNDS AND USES THEREFOR
-
Sheet 9/20, (2016/04/19)
Described herein are novel divalent nucleobases that each bind two nucleic acid strands, matched or mismatched when incorporated into a nucleic acid or nucleic acid analog backbone (a genetic recognition reagent, or genetic recognition reagent). In one embodiment, the genetic recognition reagent is a peptide nucleic acid (PNA) or gamma PNA (?PNA) oligomer. Uses of the divalent nucleobases and monomers and genetic recognition reagents containing the divalent nucleobases also are provided.
