6281-75-0 Usage
Uses
Used in Pharmaceutical Industry:
1,2-Dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxonicotinonitrile is used as an intermediate in the synthesis of various drugs, including some antibiotics. Its unique chemical structure and properties make it a valuable component in the development of new pharmaceuticals.
Used in Agrochemical Industry:
1,2-Dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxonicotinonitrile is used in the production of pesticides and insecticides due to its antimicrobial properties. It helps in controlling pests and diseases in agricultural settings, contributing to increased crop yields and food security.
Used in Organic Synthesis:
1,2-Dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxonicotinonitrile has potential applications in the field of organic synthesis due to its unique chemical structure. It can be used to create new compounds with various applications in different industries.
Used in Medicinal Chemistry:
1,2-Dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxonicotinonitrile is also used in medicinal chemistry for the development of new drugs and therapeutic agents. Its unique properties allow for the exploration of its potential in treating various diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 6281-75-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6281-75:
(6*6)+(5*2)+(4*8)+(3*1)+(2*7)+(1*5)=100
100 % 10 = 0
So 6281-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O4/c1-5-8(12(14)15)7(4-16-2)6(3-10)9(13)11-5/h4H2,1-2H3,(H,11,13)
6281-75-0Relevant academic research and scientific papers
Cetina, Mario,Tranfi?, Marina,Sviben, Igor,Juki?, Marijana
, p. 25 - 32 (2010)
Three pyridine derivatives, 4-(methoxymethyl)-6-methyl-2-oxo-1,2-dihydropyridine-3-carbonitrile (1), 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1,2-dihydropyridine-3-carbonitrile (2) and 4-(methoxymethyl)-1,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitril
