62985-18-6 Usage
General Description
"Benzoic acid, 2-[(2-cyanoethyl)amino]- (9CI)" is a complex chemical compound that belongs to the group of benzoic acid and its derivatives. It includes functional groups like amine and nitrile. Its molecular formula is C10H10N2O2 and features characteristics such as a 2-cyanoethyl amino group attached to the second carbon of benzoic acid. This chemical compound, like other benzoic acids, is typically used in the creation of consumer products like food and cosmetics due to their preservative properties. Its individual properties (such as solubility, boiling point, etc.) and potential toxicity or safe-use recommendations would be specific to this compound and would be best learned through more detailed research.
Check Digit Verification of cas no
The CAS Registry Mumber 62985-18-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,9,8 and 5 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62985-18:
(7*6)+(6*2)+(5*9)+(4*8)+(3*5)+(2*1)+(1*8)=156
156 % 10 = 6
So 62985-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2/c11-6-3-7-12-9-5-2-1-4-8(9)10(13)14/h1-2,4-5,12H,3,7H2,(H,13,14)
