6310-26-5 Usage
General Description
2-(carboxymethylsulfanylcarbothioyloxy)acetic acid is a chemical compound with a complex structure. It contains a carboxylic acid group, a sulfur atom connected to a carbon atom through a thioester linkage, and a carboxymethyl group. 2-(carboxymethylsulfanylcarbothioyloxy)acetic acid is commonly used in the pharmaceutical and chemical industries as a chelating agent and as a precursor to other chemicals. It has potential applications in metal ion sequestration, water treatment, and as a component in pharmaceutical formulations. Additionally, this compound has the potential to be used in organic synthesis and as an intermediate in the production of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6310-26-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6310-26:
(6*6)+(5*3)+(4*1)+(3*0)+(2*2)+(1*6)=65
65 % 10 = 5
So 6310-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H6O5S2/c6-3(7)1-10-5(11)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)
