6339-03-3 Usage
Chemical structure
A chemical compound derived from glucose with modifications to its hydroxyl groups.
Functionality
Used as a protecting group for hydroxyl functional groups on the glucose molecule in organic synthesis.
Protective groups
Presence of isopropylidene and benzoyl groups temporarily shield reactive hydroxyl groups.
Application
Important in carbohydrate chemistry and widely used in the synthesis of complex carbohydrate-based molecules.
Reactivity
Due to its reactivity, it is typically handled and stored under controlled conditions.
Health hazards
Potential health hazards associated with its use, necessitating careful handling and storage.
Appearance
Likely a solid or crystalline substance, though the specific appearance is not provided in the material.
Stability
Requires controlled conditions for storage, suggesting it may be sensitive to environmental factors such as light, heat, or moisture.
Check Digit Verification of cas no
The CAS Registry Mumber 6339-03-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,3 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6339-03:
(6*6)+(5*3)+(4*3)+(3*9)+(2*0)+(1*3)=93
93 % 10 = 3
So 6339-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C30H28O9/c1-30(2)38-25-24(36-28(33)21-16-10-5-11-17-21)23(37-29(25)39-30)22(35-27(32)20-14-8-4-9-15-20)18-34-26(31)19-12-6-3-7-13-19/h3-17,22-25,29H,18H2,1-2H3