65645-56-9 Usage
Uses
Used in Chemical Synthesis Industry:
2-METHYL-1H-PYRROLO[2,3-C]PYRIDINE is used as a chemical intermediate for the synthesis of various compounds due to its unique heterocyclic structure and reactivity with other chemical entities.
Used in Pharmaceutical Industry:
2-METHYL-1H-PYRROLO[2,3-C]PYRIDINE is used as a building block in the development of pharmaceutical compounds, potentially contributing to the creation of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
2-METHYL-1H-PYRROLO[2,3-C]PYRIDINE is used as a precursor in the production of agrochemicals, such as pesticides and herbicides, due to its ability to form stable and effective molecules for crop protection.
Used in Dye and Pigment Industry:
2-METHYL-1H-PYRROLO[2,3-C]PYRIDINE is used as a component in the formulation of dyes and pigments, taking advantage of its chemical properties to create stable and vibrant colorants for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 65645-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,6,4 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 65645-56:
(7*6)+(6*5)+(5*6)+(4*4)+(3*5)+(2*5)+(1*6)=149
149 % 10 = 9
So 65645-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2/c1-6-4-7-2-3-9-5-8(7)10-6/h2-5,10H,1H3
