65698-59-1 Usage
Type of compound
Carboxylic acid
Functional group
Contains a carbon atom bonded to an oxygen atom and a hydroxyl group
Derivative of
Phenanthrene, a polycyclic aromatic hydrocarbon
Uses
Organic synthesis and pharmaceutical research as a building block for the synthesis of various organic compounds
Potential applications
Development of new drugs due to its biological activities
Environmental impact
Potential environmental contaminant as a byproduct of various industrial processes
Check Digit Verification of cas no
The CAS Registry Mumber 65698-59-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,6,9 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 65698-59:
(7*6)+(6*5)+(5*6)+(4*9)+(3*8)+(2*5)+(1*9)=181
181 % 10 = 1
So 65698-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H12O2/c1-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15(10)16(17)18/h2-9H,1H3,(H,17,18)
