658-99-1 Usage
Uses
Used in Chemical Synthesis:
3,4-Difluorophenylacetonitrile is used as an intermediate in the chemical synthesis industry for the production of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structural features make it a valuable building block for the development of novel compounds with specific biological activities and applications.
The specific application reasons for 3,4-Difluorophenylacetonitrile in chemical synthesis are as follows:
1. Structural Diversity: The presence of fluorine atoms and the nitrile group in the molecule allows for a wide range of chemical reactions, leading to the formation of diverse chemical products.
2. Enhanced Properties: The introduction of fluorine atoms can significantly alter the physical, chemical, and biological properties of the resulting compounds, making them more suitable for specific applications.
3. Reactivity: The nitrile group in 3,4-Difluorophenylacetonitrile is a versatile functional group that can participate in various reactions, such as hydrolysis, reduction, and addition reactions, enabling the synthesis of a broad range of products.
Check Digit Verification of cas no
The CAS Registry Mumber 658-99-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 658-99:
(5*6)+(4*5)+(3*8)+(2*9)+(1*9)=101
101 % 10 = 1
So 658-99-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3H2
