660425-16-1 Usage
General Description
2-Bromo-3,5-difluoropyridine is a chemical compound with the molecular formula C5H2BrF2N. It is a pyridine derivative containing two fluorine atoms and a bromine atom. 2-Bromo-3,5-difluoropyridine is commonly used in pharmaceutical and agrochemical research for the synthesis of new drugs and pesticides. It has the potential to act as a building block in the construction of biologically active molecules due to its unique structure and reactivity. Additionally, it can also be used as a reagent in organic synthesis to introduce fluorine and bromine atoms into organic compounds, which can be valuable for various applications in chemical and pharmaceutical industries. Overall, 2-Bromo-3,5-difluoropyridine is a versatile and valuable compound that plays a crucial role in the development of new materials and chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 660425-16-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,0,4,2 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 660425-16:
(8*6)+(7*6)+(6*0)+(5*4)+(4*2)+(3*5)+(2*1)+(1*6)=141
141 % 10 = 1
So 660425-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H2BrF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H
660425-16-1Relevant articles and documents
DIFLUOROETHYLPYRIDINE DERIVATIVES AS NR2B NMDA RECEPTOR ANTAGONISTS
-
Paragraph 0210, (2016/02/16)
Disclosed are chemical entities of formula (I) wherein X, Y, Z, R1, R3, R4, R5 and R6 are defined herein, as NR2B subtype selective receptor antagonists. Also disclosed are pharmaceutical compositions comprising a chemical entity of formula (I), and methods of treating various diseases and disorders associated with NR2B antagonism, e.g., diseases and disorders of the CNS, such as depression, by administering a chemical entity of formula I.
