6633-42-7 Usage
Description
2,3-Diamino-9H-fluoren-9-one is a chemical compound with the molecular formula C13H11N3O. It is a derivative of fluorenone and contains two amino groups, which gives it potential as a fluorescent dye and as a building block for organic synthesis. Its unique structure and properties make it a valuable tool for the advancement of various fields of science and technology.
Uses
Used in Electronic and Optoelectronic Devices:
2,3-Diamino-9H-fluoren-9-one is used as a building block for the development of new materials in electronic and optoelectronic devices. Its chemical properties contribute to the creation of innovative materials with enhanced performance and functionality.
Used in Fluorescent Dyes:
2,3-Diamino-9H-fluoren-9-one is used as a fluorescent dye due to its potential to emit light upon exposure to certain wavelengths. This makes it suitable for applications in imaging, detection, and analysis.
Used in Biological Applications:
2,3-Diamino-9H-fluoren-9-one is used as a building block for the development of fluorescent sensors and probes for biological applications. Its chemical structure allows for the creation of sensitive and specific detection tools for various biological processes and molecules.
Used in Organic Synthesis:
2,3-Diamino-9H-fluoren-9-one is used as a starting material in organic synthesis, enabling the creation of a wide range of complex molecules with potential applications in various industries, such as pharmaceuticals, materials science, and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 6633-42-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6633-42:
(6*6)+(5*6)+(4*3)+(3*3)+(2*4)+(1*2)=97
97 % 10 = 7
So 6633-42-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2O/c14-11-5-9-7-3-1-2-4-8(7)13(16)10(9)6-12(11)15/h1-6H,14-15H2
