6635-35-4 Usage
Uses
Used in Dye and Pigment Production:
2,4,5-Triaminonitrobenzene is used as a key intermediate in the synthesis of dyes and pigments, contributing to the vibrant colors and properties of these substances. Its unique chemical structure allows for the creation of a wide range of colorants used in various industries.
Used in Chemical Research and Synthesis:
As an important intermediate, 2,4,5-Triaminonitrobenzene is utilized in chemical research and synthesis for the development of new compounds and materials. Its presence in the benzene ring with multiple functional groups makes it a versatile building block for creating a diverse array of chemical products.
Used in Pharmaceutical Industry:
2,4,5-Triaminonitrobenzene is used as a starting material or intermediate in the synthesis of certain pharmaceutical compounds. Its unique structure allows for the development of drugs with specific therapeutic properties, contributing to advancements in medicine.
Used in Agricultural Chemicals:
In the agricultural sector, 2,4,5-Triaminonitrobenzene is employed in the production of various agrochemicals, such as pesticides and herbicides. Its role in these applications helps to protect crops and enhance agricultural productivity.
Used in Specialty Chemicals:
2,4,5-Triaminonitrobenzene is also used in the manufacturing of specialty chemicals, which are tailored for specific applications in industries such as plastics, coatings, and textiles. Its versatility in chemical reactions enables the creation of unique and high-performance materials.
Check Digit Verification of cas no
The CAS Registry Mumber 6635-35-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6635-35:
(6*6)+(5*6)+(4*3)+(3*5)+(2*3)+(1*5)=104
104 % 10 = 4
So 6635-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H,7-9H2
