67810-86-0 Usage
Uses
Used in Organic Synthesis:
(1-methoxyethyl)cyclohexane is used as a building block in organic synthesis for the creation of more complex organic molecules. Its unique structure allows for various chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (1-methoxyethyl)cyclohexane is used as an intermediate in the production of various drugs. Its ability to participate in a range of chemical reactions makes it suitable for the synthesis of active pharmaceutical ingredients (APIs) and other medicinal compounds.
Used as a Solvent:
Due to its unique structure and properties, (1-methoxyethyl)cyclohexane is used as a solvent in various industrial processes. It can dissolve a wide range of substances, making it useful in applications such as chemical reactions, extraction processes, and the formulation of products in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 67810-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,1 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67810-86:
(7*6)+(6*7)+(5*8)+(4*1)+(3*0)+(2*8)+(1*6)=150
150 % 10 = 0
So 67810-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H18O/c1-8(10-2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3
