6913-13-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Amino-3-methylthio-1,2,4-thiadiazole is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic applications. Its unique structure allows for the creation of molecules with specific biological activities, enhancing the range of treatments available for various medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Amino-3-methylthio-1,2,4-thiadiazole is employed as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to the development of more effective and targeted agricultural products, contributing to increased crop yields and protection against pests.
Used in Organic Synthesis:
5-Amino-3-methylthio-1,2,4-thiadiazole is utilized as a building block in organic synthesis, allowing chemists to construct a variety of biologically active molecules with potential applications in medicine, agriculture, and other fields. Its versatility in forming different chemical structures makes it a valuable component in the synthesis of complex organic compounds.
Used in Antimicrobial Applications:
Due to its antimicrobial properties, 5-Amino-3-methylthio-1,2,4-thiadiazole is studied for use in applications targeting the inhibition of microbial growth. This can be particularly useful in the development of new antimicrobial agents to combat drug-resistant bacteria and other pathogens.
Used in Antiproliferative Applications:
The antiproliferative properties of 5-Amino-3-methylthio-1,2,4-thiadiazole make it a candidate for use in applications aimed at controlling the proliferation of cells, such as in cancer treatment. Its potential to inhibit cell growth could lead to the development of new therapeutic strategies for managing and treating various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 6913-13-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,1 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6913-13:
(6*6)+(5*9)+(4*1)+(3*3)+(2*1)+(1*3)=99
99 % 10 = 9
So 6913-13-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N3S2/c1-7-3-5-2(4)8-6-3/h1H3,(H2,4,5,6)
6913-13-9Relevant academic research and scientific papers
NOVEL AZO COMPOUND AND AZO COLORANT
-
Paragraph 0026; 0027, (2017/04/11)
The present disclosure provides a compound represented by the following formula (1).
Azo dye and azo compound
-
Page/Page column 18; 19, (2008/12/07)
An azo dye including a compound represented by formula (I): wherein R1 represents a hydroxyl group, an aliphatic sulfonyl amino group, an aryl sulfonyl amino group, an aliphatic oxy group, an aryloxy group, or -CH(R2)(R3); R2 and R3 each represent a substituent with a a value of the Hammett's rule in the range of 0.2 or more and less than 1.4, and may be identical to or different from each other; W represents a sulfur atom or -N-(-R4)-; R4 represents a substituent; R5 represents a substituent; X, Y, and Z each represent an atom required for forming a five-membered aromatic heterocycle, where at least one atom of X, Y, and Z represents a nitrogen atom but both X and Y do not represent a carbon atom when Z represents a nitrogen atom; and R6 represents a hydrogen atom or a substituent, n represents 1 or 2, and two R6s may be coupled together to form an aromatic ring or a heteroaromatic ring when n represents 2.
Oxidative cyclization of dithiobiuret under basic conditions and theoretical tautomeric studies of 5-amino-2,3-dihydro-1,2,4-thiadiazole-3-thione
Cho, Nam Sook,Kim, Young Hoon,Park, Mi Sun,Kim, Eun Hee,Kang, Sung Kwon,Park, Chang-Moon
, p. 1401 - 1409 (2007/10/03)
The oxidative cyclization of dithiobiuret under basic conditions (NaOH-H2O2 or CH3CO3H) afforded bis(5-amino-1,2,4-thiadiazolyl) 3,3′-disulfide (5), oxidative dimer form of 5-amino-3-mercapto-1,2,4-thiadiazole (
