6954-40-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(2-Chloro-phenyl)-succinic acid is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs with antibacterial and antitumor properties. Its unique structure allows for the creation of molecules that can target specific biological pathways, offering novel treatment options for various diseases.
Used in Agrochemical Production:
In the agrochemical industry, 2-(2-Chloro-phenyl)-succinic acid is utilized as a building block for the development of new pesticides and herbicides. Its chemical properties enable the design of compounds that can effectively control pests and weeds, thereby increasing crop yields and ensuring food security.
Used in Advanced Material Manufacturing:
2-(2-Chloro-phenyl)-succinic acid is employed as a component in the production of advanced materials, such as polymers and composites, due to its ability to enhance the properties of these materials. Its incorporation can lead to improved mechanical strength, thermal stability, and other desirable characteristics, making it valuable in various high-performance applications.
Used in Polymer Manufacturing:
As a monomer or a building block, 2-(2-Chloro-phenyl)-succinic acid is used in the manufacturing of polymers to create materials with specific properties tailored for various industrial applications. Its presence in the polymer chain can influence the material's chemical resistance, mechanical properties, and other performance characteristics, broadening its potential uses in diverse sectors.
Overall, 2-(2-Chloro-phenyl)-succinic acid is a multifaceted compound with a wide range of potential applications across different industries. Its continued research and development will likely uncover additional uses, further solidifying its importance in the scientific and industrial communities.
Check Digit Verification of cas no
The CAS Registry Mumber 6954-40-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6954-40:
(6*6)+(5*9)+(4*5)+(3*4)+(2*4)+(1*0)=121
121 % 10 = 1
So 6954-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClO4/c11-8-4-2-1-3-6(8)7(10(14)15)5-9(12)13/h1-4,7H,5H2,(H,12,13)(H,14,15)
