72128-24-6 Usage
Uses
Used in Semiconductor Industry:
Cesium trichlorogerminate is utilized as a crucial component in the production of semiconductor materials. Its unique properties contribute to the development of advanced semiconductors that are essential for various electronic devices and technologies.
Used in Chemical Synthesis:
CESIUM TRICHLOROGERMANATE serves as a precursor for the synthesis of other germanium-containing compounds. Its role in chemical synthesis is vital for creating new materials with specific properties required for different applications in the chemical and materials science industries.
Used in Optics and Optoelectronics:
Cesium trichlorogerminate has been studied for its potential applications in the field of optics and optoelectronics. Its properties make it a candidate for use in the development of optical devices and systems, as well as in optoelectronic components that are integral to various modern technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 72128-24-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,2 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72128-24:
(7*7)+(6*2)+(5*1)+(4*2)+(3*8)+(2*2)+(1*4)=106
106 % 10 = 6
So 72128-24-6 is a valid CAS Registry Number.
InChI:InChI=1/Cl3Ge.Cs/c1-4(2)3;/q-1;+1
72128-24-6Relevant academic research and scientific papers
Lin, Zhi-Guang,Tang, Li-Chuan,Chou, Chang-Pin
, p. 2362 - 2367 (2008)
Innovative infrared nonlinear optical crystals CsGe(BrxCl 1-x)3 were synthesized. Their powder X-ray diffraction patterns indicated that they had rhombohedral structures with (R3m, No. 160) space group symmetry. Their stru
