72235-54-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-fluoro-benzylamine is used as a key intermediate for the synthesis of various drugs, including antihistamines and antipsychotics. Its unique structure allows for the development of medications that target specific receptors or pathways in the body, offering potential therapeutic benefits for a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-3-fluoro-benzylamine is utilized as a building block for the production of herbicides and insecticides. Its chemical properties enable the creation of compounds that effectively control pests and weeds, thereby protecting crops and increasing agricultural productivity.
Used in Cancer Research:
2-Chloro-3-fluoro-benzylamine has been studied for its potential use in the treatment of cancer. Its unique structure may allow for the development of compounds that target cancer cells specifically, leading to more effective treatments with fewer side effects.
Used in Neurological Disorder Research:
2-Chloro-3-fluoro-benzylamine is also being investigated for its potential applications in the treatment of neurological disorders. The specific interactions of 2-Chloro-3-fluoro-benzylamine with biological systems may offer new avenues for the development of therapies to address various neurological conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 72235-54-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,3 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72235-54:
(7*7)+(6*2)+(5*2)+(4*3)+(3*5)+(2*5)+(1*4)=112
112 % 10 = 2
So 72235-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClFN/c8-7-5(4-10)2-1-3-6(7)9/h1-3H,4,10H2
72235-54-2Relevant academic research and scientific papers
METHODS OF TREATING ALPHA ADRENERGIC MEDIATED CONDITIONS
-
Page/Page column 7, (2009/12/24)
Described herein are compounds for and methods of treating conditions or diseases in a subject by administering to the subject a pharmaceutical composition containing an effective amount of an α-adrenergic modulator. The compounds and methods are also use
