72415-57-7 Usage
Uses
Used in Pharmaceutical Industry:
4-(acetyloxy)-3-bromobenzoic acid is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and functional groups. The presence of the acetyl group and bromine atom allows for the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4-(acetyloxy)-3-bromobenzoic acid serves as a key intermediate for the synthesis of various agrochemicals, such as pesticides and herbicides. Its chemical properties make it a valuable component in the development of effective and environmentally friendly agrochemical products.
Used in Cosmetics Industry:
4-(acetyloxy)-3-bromobenzoic acid is used as a preservative in cosmetics and topical medications. Its ability to inhibit the growth of microorganisms helps maintain the stability and safety of cosmetic products, ensuring their longevity and preventing contamination.
Used in Industrial Manufacturing:
4-(acetyloxy)-3-bromobenzoic acid is utilized in the manufacturing of various industrial products, such as dyes, plastics, and coatings. Its chemical properties contribute to the development of innovative materials with enhanced performance characteristics.
However, it is important to note that 4-(acetyloxy)-3-bromobenzoic acid should be handled with care due to its potential health hazards. Proper safety measures and precautions should be taken during its production, use, and disposal to minimize any adverse effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 72415-57-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,4,1 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 72415-57:
(7*7)+(6*2)+(5*4)+(4*1)+(3*5)+(2*5)+(1*7)=117
117 % 10 = 7
So 72415-57-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrO4/c1-5(11)14-8-3-2-6(9(12)13)4-7(8)10/h2-4H,1H3,(H,12,13)
72415-57-7Relevant academic research and scientific papers
Tetrahydroquinoline and tetrahydroisoquinoline compounds and application thereof
-
Paragraph 0026; 0037-0040, (2020/11/09)
The invention provides tetrahydroquinoline and tetrahydroisoquinoline compounds and application of the tetrahydroquinoline and tetrahydroisoquinoline compounds. Specifically, the invention provides the tetrahydroquinoline and tetrahydroisoquinoline compounds as shown in a formula I, physiologically acceptable salts, solvates and crystal forms thereof, a pharmaceutical preparation containing the compounds, and application of the compounds in clinical treatment of human urate transporter 1 related diseases such as hyperuricemia, gout and the like.
A where the shall he loni intermediate and its preparation method
-
Paragraph 0129-0132, (2019/04/04)
The present invention provides a where the shall he loni intermediate and its preparation method, the where the shall he loni intermediate by compound 8 in the sodium methoxide or metal lithium, sodium, potassium and the like under the action 9 acidifying the resulting: Wherein X fluorine, chlorine, bromine, move in the halogen, R3 is lithium, sodium, potassium and the like metal. The invention conducive to product quality control, the reaction condition is more simple, moderate, environmental protection, high requirements on equipment, each step the reaction yield is higher.