730-08-5 Usage
General Description
H-TYR-ALA-OH is a chemical compound consisting of the amino acids tyrosine (TYR) and alanine (ALA) joined together by a peptide bond. It is commonly used as a building block in the synthesis of peptides and proteins. Tyrosine is an aromatic amino acid that plays a crucial role in the synthesis of neurotransmitters and hormones, while alanine is a non-essential amino acid that is important for maintaining proper blood sugar levels and energy production. The "-OH" at the end of the compound's name indicates that it has a hydroxyl group, which can affect its solubility and reactivity in chemical reactions. Overall, H-TYR-ALA-OH is a versatile compound with various biological and chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 730-08-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,3 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 730-08:
(5*7)+(4*3)+(3*0)+(2*0)+(1*8)=55
55 % 10 = 5
So 730-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O4/c1-7(12(17)18)14-11(16)10(13)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m0/s1
