73455-13-7 Usage
Uses
Used in Agricultural Industry:
4,5-Dichloropicolinic acid is used as a herbicide for the control of broadleaf weeds in various crops such as soybeans, wheat, and corn. It functions by inhibiting the synthesis of the amino acid tryptophan in target plants, which leads to their growth inhibition and eventual death, thus ensuring healthier and more productive crops.
Additionally, due to its low acute toxicity to humans and animals, 4,5-DCPA is considered a safer option for weed control in comparison to more toxic herbicides. However, it is crucial to handle this chemical with care and follow safety guidelines to prevent any potential negative health effects on humans and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 73455-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,5 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73455-13:
(7*7)+(6*3)+(5*4)+(4*5)+(3*5)+(2*1)+(1*3)=127
127 % 10 = 7
So 73455-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2NO2/c7-3-1-5(6(10)11)9-2-4(3)8/h1-2H,(H,10,11)
