73926-95-1 Usage
Description
2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester is a chemical compound with the molecular formula C14H24O7. It is an ester derivative of 3-formylbutanedioic acid, characterized by its colorless liquid appearance, slightly sweet odor, and solubility in organic solvents such as acetone, ethanol, and ether. 2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester is sensitive to air and light, and is known for its versatile reactivity and functional groups, making it a valuable reagent in organic synthesis.
Uses
Used in Pharmaceutical Industry:
2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester is used as a reagent for the synthesis of various drugs and pharmaceutical intermediates. Its versatile reactivity and functional groups make it a valuable component in the development of new medications.
Used in Organic Synthesis:
2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester is used as a reagent for the preparation of various compounds in organic synthesis. Its functional groups and reactivity contribute to the creation of a wide range of chemical products.
Used in Medicinal Chemistry Research:
2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester is used as a research compound in the field of medicinal chemistry. Its potential applications and interactions with biological systems are studied to explore its possible uses in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 73926-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,9,2 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73926-95:
(7*7)+(6*3)+(5*9)+(4*2)+(3*6)+(2*9)+(1*5)=161
161 % 10 = 1
So 73926-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H24O7/c1-5-18-12(16)10(9-15)11(13(17)19-6-2)14(20-7-3)21-8-4/h9-11,14H,5-8H2,1-4H3