74307-75-8 Usage
Uses
Used in Pharmaceutical Research:
Trans-3-aminocyclobutanecarboxylic acid is utilized as a key component in the development of innovative drugs, targeting a range of diseases. Its unique structural properties allow for the creation of diverse organic compounds that can be tailored for specific therapeutic applications.
Used in Organic Chemistry:
In the field of organic chemistry, trans-3-aminocyclobutanecarboxylic acid serves as an important intermediate for the synthesis of complex molecules. Its versatility in forming various chemical bonds and its compatibility with different synthetic pathways make it a valuable asset in the creation of advanced organic compounds.
Used in Drug Development:
Trans-3-aminocyclobutanecarboxylic acid is employed as a precursor in the synthesis of pharmaceutical agents. Its presence in the molecular structure can influence the drug's pharmacokinetics and pharmacodynamics, potentially enhancing efficacy and selectivity in treating specific conditions.
Used in Chemical Industry:
TRANS-3-AMINOCYCLOBUTANECARBOXYLIC ACID is also used in the chemical industry for the production of specialty chemicals and materials. Its ability to form stable complexes and its reactivity in various chemical reactions contribute to its utility in creating high-value products.
Check Digit Verification of cas no
The CAS Registry Mumber 74307-75-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,3,0 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 74307-75:
(7*7)+(6*4)+(5*3)+(4*0)+(3*7)+(2*7)+(1*5)=128
128 % 10 = 8
So 74307-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2/c6-4-1-3(2-4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4-
74307-75-8Relevant academic research and scientific papers
Expedient synthesis of cis- and trans-3-aminocyclobutanecarboxylic acids
Radchenko, Dmytro S.,Tkachenko, Anton,Grygorenko, Oleksandr O.,Komarov, Igor V.
, p. 1644 - 1649 (2011/06/23)
An expedient approach to cis- and trans-3-aminocyclobutanecarboxylic acids was developed starting from 1,1-cyclobutanedicarboxylic acid. Stereochemistry of the title compounds was established by nuclear Overhauser effect spectroscopy experiments.
