76198-36-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-2-norbornanecarboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique cyclic structure and functional groups contribute to the development of new drugs with enhanced properties and therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Amino-2-norbornanecarboxylic acid serves as a valuable intermediate for the production of agrochemicals. Its incorporation into the molecular structures of these compounds can lead to improved efficacy in agricultural applications.
Used in Peptide Synthesis:
3-Amino-2-norbornanecarboxylic acid is employed as a building block in peptide synthesis. The presence of an amino group allows it to be incorporated into peptide chains, potentially leading to the creation of novel bioactive peptides with specific functions.
Used in Material Science:
3-AMINO-2-NORBORNANECARBOXYLIC ACID is being explored for its potential use in the development of new materials. Its cyclic structure and chemical properties may contribute to the creation of innovative materials with unique properties for various applications.
Used in Catalyst Development:
3-Amino-2-norbornanecarboxylic acid is also under investigation for its possible role in the development of new catalysts. Its structural and chemical characteristics could be harnessed to improve catalytic processes in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 76198-36-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,1,9 and 8 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76198-36:
(7*7)+(6*6)+(5*1)+(4*9)+(3*8)+(2*3)+(1*6)=162
162 % 10 = 2
So 76198-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO2/c9-7-5-2-1-4(3-5)6(7)8(10)11/h4-7H,1-3,9H2,(H,10,11)
