76198-36-2 Usage
General Description
3-Amino-2-norboranecarboxylic acid is a chemical compound with the molecular formula C8H13NO2. It is a cyclic amino acid that contains a norbornane ring structure. 3-AMINO-2-NORBORNANECARBOXYLIC ACID is commonly used as a building block in organic synthesis, and its unique structure makes it a valuable intermediate for the production of pharmaceuticals and agrochemicals. The presence of an amino group and a carboxylic acid group in its structure makes it useful in the synthesis of peptides and other bioactive molecules. Additionally, 3-Amino-2-norboranecarboxylic acid is also being investigated for its potential use in the development of new materials and catalysts due to its interesting structural and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 76198-36-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,1,9 and 8 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76198-36:
(7*7)+(6*6)+(5*1)+(4*9)+(3*8)+(2*3)+(1*6)=162
162 % 10 = 2
So 76198-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO2/c9-7-5-2-1-4(3-5)6(7)8(10)11/h4-7H,1-3,9H2,(H,10,11)
