76919-41-0 Usage
Uses
Used in Medicinal Chemistry:
(6-Phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is used as a compound of interest in medicinal chemistry for its potential biological activities. Its unique structure, including the imidazole and thiazole rings, may contribute to its interactions with biological targets, making it a candidate for drug development.
Used in Scientific Research:
In the field of scientific research, (6-Phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is used as a subject of study to understand its properties, interactions, and potential applications. (6-PHENYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL's structure and the presence of heterocyclic rings make it an intriguing molecule for exploring its reactivity and possible uses in various chemical processes.
Used in Drug Development:
(6-Phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is used as a potential lead compound in drug development. Its structure may allow for modifications and optimizations to enhance its biological activity, making it a valuable starting point for the creation of new therapeutic agents.
Used in Chemical Synthesis:
In the chemical synthesis industry, (6-Phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol may be used as a building block or intermediate in the synthesis of more complex molecules. Its unique structure could be exploited to create novel compounds with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 76919-41-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,9,1 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 76919-41:
(7*7)+(6*6)+(5*9)+(4*1)+(3*9)+(2*4)+(1*1)=170
170 % 10 = 0
So 76919-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2OS/c15-8-10-11(9-4-2-1-3-5-9)13-12-14(10)6-7-16-12/h1-7,15H,8H2
76919-41-0Relevant academic research and scientific papers
COMPOSTI A PRESUNTA ATTIVITA ANTITUMORALE. VI - Esteri di 5-idrossimetilimidazotiazoli 6-sostituiti
Andreani, A.,Bonazzi, D.,Rambaldi, M.
, p. 896 - 901 (2007/10/02)
6-Substituted 5-hydroxymethylimidazothiazoles and 2,3-dihydro-5-hydroxymethylimidazothiazoles (VII - XII) were prepared by reducing the corresponding aldehydes (I - VI) with NaBH4.Among the acetic (VII a - XII a), methylcarbamic (VII b - XII b) and ethylcarbamic esters (VII c - XII c), compound (VII a) was active in a preliminary P388 leukemia test.
