77966-47-3 Usage
Uses
Used in Pharmaceutical Industry:
(4-chloro-2-methyl-phenyl)carbamoylmethyl-diethyl-azanium chloride is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and biological activity make it a promising candidate for the development of new drugs, particularly those targeting specific receptors or enzymes in the human body.
Used in Agrochemical Industry:
In the agrochemical industry, (4-chloro-2-methyl-phenyl)carbamoylmethyl-diethyl-azanium chloride is used as a building block for the creation of novel agrochemical products. Its potential applications include the development of new pesticides, herbicides, or other agricultural chemicals that can improve crop yield and protect plants from pests and diseases.
Used in Chemical Research:
(4-chloro-2-methyl-phenyl)carbamoylmethyl-diethyl-azanium chloride is also utilized in chemical research as a model compound to study the properties and behavior of various chemicals. Researchers can use (4-chloro-2-methyl-phenyl)carbamoylmethyl-diethyl-azanium chloride to gain insights into the interactions between different molecular structures and their effects on chemical reactivity, stability, and other properties.
Additional research is necessary to fully understand the properties and potential applications of (4-chloro-2-methyl-phenyl)carbamoylmethyl-diethyl-azanium chloride, as well as to explore its possible uses in other industries and fields.
Check Digit Verification of cas no
The CAS Registry Mumber 77966-47-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,9,6 and 6 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 77966-47:
(7*7)+(6*7)+(5*9)+(4*6)+(3*6)+(2*4)+(1*7)=193
193 % 10 = 3
So 77966-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H19ClN2O.ClH/c1-4-16(5-2)9-13(17)15-12-7-6-11(14)8-10(12)3;/h6-8H,4-5,9H2,1-3H3,(H,15,17);1H
