78551-38-9 Usage
Uses
Used in Pharmaceutical Synthesis:
(S)-3-METHYL-2-KETOPIPERAZINE is utilized as a building block in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for versatile chemical modifications, making it a valuable component in medicinal chemistry.
Used in Metal-Catalyzed Reactions:
As a ligand, (S)-3-METHYL-2-KETOPIPERAZINE plays a crucial role in metal-catalyzed reactions, enhancing the efficiency and selectivity of these processes. Its ability to coordinate with metal centers is instrumental in various catalytic applications, facilitating the advancement of chemical synthesis techniques.
Used in the Development of Novel Materials:
(S)-3-METHYL-2-KETOPIPERAZINE is being investigated for its potential use in the development of novel materials, such as polymers, coatings, and composites. Its unique properties may contribute to the creation of innovative materials with enhanced performance characteristics for various applications.
Used as a Reagent in Organic Chemistry:
In the realm of organic chemistry, (S)-3-METHYL-2-KETOPIPERAZINE serves as a reagent, enabling specific transformations and reactions that are otherwise challenging to achieve. Its presence can facilitate the synthesis of complex organic molecules, broadening the scope of organic synthesis.
Overall, (S)-3-METHYL-2-KETOPIPERAZINE's diverse applications in pharmaceuticals, catalysis, material science, and organic chemistry underscore its significance as a versatile and valuable compound in the scientific and industrial sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 78551-38-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,5,5 and 1 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 78551-38:
(7*7)+(6*8)+(5*5)+(4*5)+(3*1)+(2*3)+(1*8)=159
159 % 10 = 9
So 78551-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O/c1-4-5(8)7-3-2-6-4/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m0/s1
78551-38-9Relevant academic research and scientific papers
KINETIC RESOLUTION OF CHIRAL AMINES
-
Page/Page column 69; 70; 71, (2013/03/26)
The present invention refers to a method for the kinetic resolution of a chiral primary or secondary amine by treating the amine with a chiral, hydroxamic acid derived reagent of the formula (I). These chiral reagents are particularly useful for the kinetic resolution of cyclic amines and may be generated in situ in the presence of an N-heterocyclic carbene, thus allowing for a catalytic reaction.
Expanded substrate scope and catalyst optimization for the catalytic kinetic resolution of N-heterocycles
Hsieh, Sheng-Ying,Binanzer, Michael,Kreituss, Imants,Bode, Jeffrey W.
supporting information, p. 8892 - 8894 (2012/11/07)
The scope, reactivity, and selectivity of the chiral hydroxamic acid-catalyzed kinetic resolution of chiral amines are improved by a new catalyst structure and a more environmentally friendly reaction protocol. In addition to increasing selectivity across all substrates, these conditions make possible the resolution of N-heterocycles containing lactams or other basic functional groups that can inhibit the catalyst.
