796-13-4 Usage
Explanation
This is an alternative name for the compound, which is often used in scientific literature and research.
Explanation
The compound is derived from a benzene molecule, which has a chlorine atom (Cl) attached to it. Additionally, a bromine atom (Br) is connected to a diphenylethene group, which consists of two phenyl rings (C6H5) connected by a carbon-carbon double bond (C=C).
Explanation
The compound is known for its high reactivity, making it useful in organic synthesis and chemical research. This property allows it to participate in various chemical reactions, such as cross-coupling reactions.
Explanation
Due to its high reactivity, 1-(1-bromo-2,2-diphenyl-ethenyl)-4-chloro-benzene is commonly used in the synthesis of other organic compounds and as a research tool in chemical studies.
Explanation
The compound is toxic and can cause harm if ingested, inhaled, or if it comes into contact with the skin.
Explanation
Exposure to the compound can lead to irritation of the skin, eyes, and respiratory system, making it essential to handle it with care and use appropriate protective equipment.
Explanation
The compound is flammable, which means it can easily catch fire or explode when exposed to a source of ignition. Precautions should be taken to prevent such incidents.
Explanation
Due to its toxicity, reactivity, and flammability, it is crucial to handle 1-(1-bromo-2,2-diphenyl-ethenyl)-4-chloro-benzene with care, use appropriate protective equipment (such as gloves, goggles, and a lab coat), and store it in a safe and secure location away from heat sources and ignition sources.
Chemical structure
Chlorinated benzene derivative with a bromine atom attached to a diphenylethene group
Reactivity
High reactivity
Applications
Organic synthesis and chemical research
Toxicity
Toxic
Irritation
Can cause irritation to skin, eyes, and respiratory system
Flammability
Flammable
Safety precautions
Handle with care, use protective equipment, and store in a safe and secure location
Check Digit Verification of cas no
The CAS Registry Mumber 796-13-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,9 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 796-13:
(5*7)+(4*9)+(3*6)+(2*1)+(1*3)=94
94 % 10 = 4
So 796-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H14BrCl/c21-20(17-11-13-18(22)14-12-17)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H
