80550-76-1 Usage
Uses
Used in Pharmaceutical Development:
2-(Chloromethyl)[1]benzofuro[3,2-d]pyrimidin-4(3H)-one is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique structure and properties allow it to be incorporated into drug molecules, potentially enhancing their therapeutic effects and selectivity.
Used in Medicinal Chemistry Research:
This chemical compound serves as an interesting target for researchers in medicinal chemistry. Its complex molecular structure and potential interactions with biological targets make it a valuable subject for investigation. By studying its properties and effects, researchers can gain insights into the design and development of new drugs with improved efficacy and safety profiles.
Used in Drug Discovery:
2-(Chloromethyl)[1]benzofuro[3,2-d]pyrimidin-4(3H)-one can be utilized in drug discovery processes to identify novel therapeutic agents. Its unique structure may provide a starting point for the design of new drug candidates, which can be further optimized through medicinal chemistry techniques to achieve desired pharmacological properties.
Used in Chemical Synthesis:
In addition to its applications in medicinal chemistry, 2-(Chloromethyl)[1]benzofuro[3,2-d]pyrimidin-4(3H)-one can also be employed in various chemical synthesis processes. Its versatile structure allows for the formation of different derivatives, which can be used as building blocks for the synthesis of other complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 80550-76-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,5,5 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 80550-76:
(7*8)+(6*0)+(5*5)+(4*5)+(3*0)+(2*7)+(1*6)=121
121 % 10 = 1
So 80550-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClN2O2/c12-5-8-13-9-6-3-1-2-4-7(6)16-10(9)11(15)14-8/h1-4H,5H2,(H,13,14,15)
80550-76-1Relevant academic research and scientific papers
Studies in Benzofurans: Part XII - Synthesis and Reactions of 2-Chloromethyl-3,4-dihydro-4-oxobenzofuropyrimidine
Vaidya, V. P.,Agasimundin, Y. S.
, p. 780 - 783 (2007/10/02)
Syntheses of 2-chloromethyl-3,4-dihydro-4-oxobenzofuropyrimidine (II) and 2-hydroxymethyl-3,4-dihydro-4-oxobenzofuropyrimidine (III) and their conversion into 2-chloromethyl-4-chlorobenzofuropyrimidine (IV) are reported.Various nucleophilic displacement reactions of II and IV have been investigated.