82673-73-2 Usage
Uses
Used in Pharmaceutical Industry:
3-AMINO-5-METHOXYISONICOTINIC ACID is used as a building block for the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry Research:
3-AMINO-5-METHOXYISONICOTINIC ACID is utilized as a key intermediate in the synthesis of bioactive molecules. Its presence in these molecules can contribute to their biological activities, making it a valuable tool in the discovery and optimization of new therapeutic agents.
Used in Drug Design and Development:
3-AMINO-5-METHOXYISONICOTINIC ACID is employed as a structural component in the design of novel drug candidates. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability, leading to more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 82673-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,6,7 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 82673-73:
(7*8)+(6*2)+(5*6)+(4*7)+(3*3)+(2*7)+(1*3)=152
152 % 10 = 2
So 82673-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O3/c1-12-5-3-9-2-4(8)6(5)7(10)11/h2-3H,8H2,1H3,(H,10,11)
82673-73-2Relevant academic research and scientific papers
Synthetic Application of Lithiation Reactions: A Convenient Synthesis of 3,4-Dihydro-5-hydroxycarbostyril, 1,2,3,4-Tetrahydro-5-hydroxy-2-oxo-1,7-naphthyridine, and Methyl 3-Methoxypyridine-4-carboxylate
Tamura, Yasumitsu,Chen, Ling Ching,Fujita, Masanobu,Kita, Yasuyuki
, p. 1257 - 1262 (2007/10/02)
3,4-Dihydro-5-hydroxycarbostyril (3), a key intermediate for a clinically used β-receptor blocking agent (1), and its 7-aza analog (4) were prepared by an acid-catalyzed cyclization of the N-pivaloylamino-esters (17 and 19), which were obtained by using o
