83408-94-0 Usage
Molecular structure
2-[4-oxo-2-(3,4,5-trimethoxyphenyl)quinazolin-3-yl]-3-phenyl-propanoic acid has a complex molecular structure, featuring a quinazolin-3-yl group, a phenyl group, and a propanoic acid moiety.
Quinazoline class
This chemical compound belongs to the quinazoline class of compounds, which are known for their diverse biological activities and potential pharmaceutical applications.
3,4,5-Trimethoxyphenyl substituent
The presence of the 3,4,5-trimethoxyphenyl group adds significant bulk and complexity to the molecule, which may influence its reactivity and biological properties.
Potential pharmaceutical applications
Due to its unique structure and belonging to the quinazoline class, this chemical compound may have potential applications in the pharmaceutical industry, particularly in the development of novel drugs for various therapeutic purposes.
Need for further research
To fully understand the capabilities of this chemical compound, further research and evaluation of its properties and potential uses are necessary.
Check Digit Verification of cas no
The CAS Registry Mumber 83408-94-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,4,0 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 83408-94:
(7*8)+(6*3)+(5*4)+(4*0)+(3*8)+(2*9)+(1*4)=140
140 % 10 = 0
So 83408-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C26H24N2O6/c1-32-21-14-17(15-22(33-2)23(21)34-3)24-27-19-12-8-7-11-18(19)25(29)28(24)20(26(30)31)13-16-9-5-4-6-10-16/h4-12,14-15,20H,13H2,1-3H3,(H,30,31)
83408-94-0Relevant articles and documents
2-Alkyl-2-ethanoic Acids and Their Amides as Anticonvulsant Agents
Husain, M. I.,Srivastava, G. C.,Dua, P. R.
, p. 381 - 383 (2007/10/02)
Several 2-alkyl-2-ethanoic acids (II) and their amides (IV) with diethylamine, morpholine, piperidine, pyrrolidine and piperazines have been prepared.Twenty six of them have been assayed for their anticon